76410-58-7 4-Borono-L-פנילאלנין
שם המוצר |
4-Borono-L-פנילאלנין |
נרדפות |
4-Boronophenylalanine; 10ב-BPA; para-Borono-L-פנילאלנין; para-Boronophenylalanine; ל-פנילאלנין, 4-בורונו-; 4-(dihydroxyboranyl)פנילאלנין; 4-(dihydroxyboranyl)-L-פנילאלנין |
שם אנגלי |
4-Borono-L-phenylalanine;4-Boronophenylalanine; 10B-Bpa; para-Borono-L-phenylalanine; para-Boronophenylalanine; L-Phenylalanine, 4-borono-; 4-(dihydroxyboranyl)phenylalanine; 4-(dihydroxyboranyl)-L-phenylalanine |
מולקולרית פורמולה |
C9H12BNO4 |
משקל מולקולרי |
209.0069 |
InChI |
InChI=1/C9H12BNO4/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4,8,14-15H,5,11H2,(H,12,13)/t8-/m0/s1 |
מספר CAS |
76410-58-7 |
מבנה מולקולרי |
|
צפיפות |
1.34g/cm3 |
נקודת רתיחה |
449.3°C at 760 mmHg |
משקל סגולי |
1.59 |
נקודת הבזק |
225.5°C |
לחץ אדים |
7.39E-09mmHg at 25°C |
Hazard סימנים |
Xi:Irritant;
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|